Merge pull request #3 from jiramas64/master

Add 2 modpacks

servers/JiramasGalactic-1.12.2/files/config/InvTweaks/InvTweaks.cfg

@@ -0,0 +1,23 @@
+#Inventory Tweaks Configuration
+#(Regarding shortcuts, all key names can be found at: http://legacy.lwjgl.org/javadoc/org/lwjgl/input/Keyboard.html)
+#Tue Mar 05 17:43:22 JST 2024
+enableMiddleClick=true
+showChestButtons=true
+enableSortingOnPickup=false
+enableAutoRefill=true
+autoRefillBeforeBreak=false
+autoRefillDamageThreshhold=5
+enableSounds=true
+enableShortcuts=true
+enableAutoEquipArmor=false
+enableServerItemSwap=true
+enableConfigLoadedMesssage=false
+invertToolDamageSorting=true
+shortcutKeyAllItems=LCONTROL+LSHIFT, RCONTROL+RSHIFT
+shortcutKeyEverything=SPACE
+shortcutKeyOneItem=LCONTROL, RCONTROL
+shortcutKeyToUpperSection=UP
+shortcutKeyToLowerSection=DOWN
+shortcutKeyDrop=LALT, RALT
+enableToolTipTreePath=false
+version=1.64+dev.151.822d839

servers/JiramasGalactic-1.12.2/files/config/InvTweaks/InvTweaksRules.txt

@@ -0,0 +1,31 @@
+|=================================================================|
+| INVENTORY TWEAKS Mod - https://inventory-tweaks.readthedocs.org |
+| Sorting rules and general configuration                         |
+|=================================================================|
+
+====== [ SETTINGS ] ======
+
+D LOCKED
+
+======== [ GETTING STARTED ] ========
+
+# SORTING RULES
+# Each line you type is a new constraint you add for sorting your inventory.
+# After any change, just press the sorting key to reload the settings. Some examples:
+# * "D1 sword" puts any sword in row D, column 1 (see grid below)
+# * "A edibleFood" fills the A row with food
+# * "1 ironPickaxe" fills the 1 column with an iron pickaxe
+# * "A1-C4 blocks" fills the rectangle with any blocks
+# * "D LOCKED" avoids items from the hotbar to move out of it when sorting
+
+# INVENTORY GRID
+#     1   2   3   4   5   6   7   8   9
+# A [A1][A2][A3][A4][A5][A6][A7][A8][A9]
+# B [B1][B2][B3][B4][B5][B6][B7][B8][B9]
+# C [C1][C2][C3][C4][C5][C6][C7][C8][C9]
+#  
+# D [D1][D2][D3][D4][D5][D6][D7][D8][D9]
+
+# AVAILABLE KEYWORDS
+# Open the 'InvTweaksTree.txt' file for a list of available keywords. If an item
+# is missing from the item tree (for example mod items), you can add it there.

servers/JiramasGalactic-1.12.2/files/config/InvTweaks/trees/readme.txt

@@ -0,0 +1,5 @@
+You may add additional ".tree" files to this folder and they will be merged into either the "minecraft.tree" file if it is in this folder or the normal InvTweakTree.txt file if "minecraft.tree" does not exist.  These tree files have the same structure as the InvTweakTree.txt file, and matching categories will be merged into one with nodes from the new tree file being added to the end of the matching category.
+
+You can find tree files maintained by IMarvinTPA at https://github.com/IMarvinTPA/InventoryTweaksTrees
+
+

servers/JiramasGalactic-1.12.2/files/config/appleskin.cfg

@@ -0,0 +1,29 @@
+# Configuration file
+
+##########################################################################################################
+# client
+#--------------------------------------------------------------------------------------------------------#
+# These config settings are client-side only
+##########################################################################################################
+
+client {
+    # If true, shows your food exhaustion as a progress bar behind the hunger bars
+    B:show.food.exhaustion.hud.underlay=true
+
+    # If true, adds a line that shows your hunger, saturation, and exhaustion level in the F3 debug overlay
+    B:show.food.stats.in.debug.overlay=true
+
+    # If true, shows the hunger (and saturation if show.saturation.hud.overlay is true) that would be restored by food you are currently holding
+    B:show.food.values.hud.overlay=true
+
+    # If true, shows the hunger and saturation values of food in its tooltip while holding SHIFT
+    B:show.food.values.in.tooltip=true
+
+    # If true, shows the hunger and saturation values of food in its tooltip automatically (without needing to hold SHIFT)
+    B:show.food.values.in.tooltip.always=true
+
+    # If true, shows your current saturation level overlayed on the hunger bar
+    B:show.saturation.hud.overlay=true
+}
+
+

servers/JiramasGalactic-1.12.2/files/config/bbm/AI_Improvements.cfg

@@ -0,0 +1,14 @@
+# Configuration file
+
+general {
+    # Disabled the AI segment that controls entities looking at random locations [default: false]
+    B:RemoveEntityAILookIdle=false
+
+    # Disabled the AI segment that controls entities looking at the closest player [default: false]
+    B:RemoveEntityAIWatchClosest=false
+
+    # Replaces the EntityLookHelper with a more CPU efficient version [default: true]
+    B:ReplaceLookHelper=true
+}
+
+

servers/JiramasGalactic-1.12.2/files/config/betterbiomeblend.cfg

@@ -0,0 +1,9 @@
+# Configuration file
+
+general {
+    # Min: 0
+    # Max: 14
+    I:"Blend Radius"=14
+}
+
+

servers/JiramasGalactic-1.12.2/files/config/betterfps.json

@@ -0,0 +1 @@
+{"algorithm":"rivens-half","updateChecker":true,"preallocateMemory":false,"fog":true,"beaconBeam":true,"fastHopper":true,"fastBeacon":true,"fastSearch":true,"asyncSearch":true}

servers/JiramasGalactic-1.12.2/files/config/craftingtweaks.cfg

@@ -0,0 +1,42 @@
+# Configuration file
+
+##########################################################################################################
+# addons
+#--------------------------------------------------------------------------------------------------------#
+# Here you can control whether support for a mod should be enabled, buttons_only, hotkeys_only or disabled. For Vanilla Minecraft, see the option 'minecraft'. Mods are identified by their mod ids.
+##########################################################################################################
+
+addons {
+    # enabled, buttons_only, hotkeys_only or disabled [default: enabled]
+    S:fastbench=enabled
+
+    # enabled, buttons_only, hotkeys_only or disabled [default: enabled]
+    S:minecraft=enabled
+}
+
+
+general {
+    # Set this to true if you want the (de)compress feature to work outside of crafting GUIs (only works if installed on server) [default: false]
+    B:compressAnywhere=false
+
+    # A list of modid:name entries that will not be crafted by the compress key. [default: [ExtraUtilities:decorativeBlock1], [minecraft:sandstone], [minecraft:iron_trapdoor]]
+    S:compressBlacklist <
+        ExtraUtilities:decorativeBlock1
+        minecraft:sandstone
+        minecraft:iron_trapdoor
+     >
+
+    # Set this to true if you don't want the tweak buttons' tooltips to show. [default: false]
+    B:hideButtonTooltips=false
+
+    # This option is toggled by the 'Toggle Buttons' key that can be defined in the Controls settings. [default: false]
+    B:hideButtons=false
+
+    # We both know JEI is much better. This option hides Vanilla's crafting book button instead of moving it. [default: false]
+    B:hideVanillaCraftingGuide=false
+
+    # If set to true, right-clicking the result slot in a crafting table will craft a full stack. [default: true]
+    B:rightClickCraftsStack=true
+}
+
+

servers/JiramasGalactic-1.12.2/files/config/enchdesc.cfg

@@ -0,0 +1,8 @@
+# Configuration file
+
+general {
+    # Should the mod generate a list of enchantments from the instance that have no description? [default: false]
+    B:exploreMode=false
+}
+
+

servers/JiramasGalactic-1.12.2/files/config/entityculling.cfg

@@ -0,0 +1,93 @@
+# Configuration file
+
+general {
+    # Ideally should be set to equal the render distance. Ram usage (in Bytes) = 1063 * (2x + 1) ^ 3
+    I:cacheSize=12
+    B:disabledInSpectator=true
+
+    # If you have a weak CPU enabling this option might help reducing the CPU usage.
+    B:enableRaytraceCache=false
+
+    # Disable all changes from this mod (This is not equal to removing the mod!).
+    B:enabled=true
+
+    # If enabled and OpenGl 4.4 is supported OpenGl based culling is used which is a lot faster and more accurate. If you have a weak GPU you might want to disable this.
+    B:openglBasedCulling=true
+
+    # Mode that is used to calculate the distance from camera to a raytrace end point.
+    # Valid values:
+    # SPHERICAL
+    # CYLINDRICAL
+    S:raytraceDistanceCalculator=SPHERICAL
+
+    # Used to calculate the raytrace distance limit. Points farther away than the limit are not raytraced. Distance limit = (renderDistance * 16 + adder) * multiplier
+    # Min: 0.0
+    # Max: 1024.0
+    D:raytraceDistanceLimitAdder=16.0
+
+    # Used to calculate the raytrace distance limit. Points farther away than the limit are not raytraced. Distance limit = (renderDistance * 16 + adder) * multiplier
+    # Min: 0.0
+    # Max: 1024.0
+    D:raytraceDistanceLimitMultiplier=1.0
+
+    # If you feel the need to increase this value because of entities being culled falsely then another modder probably messed up their render bounding boxes and you should report the issue to them. Alternatively you can use the (tile-)entityBoundingBoxGrowthList settings to fix bounding boxes on your own.
+    # Min: 0.0
+    # Max: 1024.0
+    D:raytraceThreshold=1.0
+
+    # If enabled tile entity bounding boxes are increased slightly to avoid issues when other mods don't correctly set their bounding boxes (requires opengl based culling). If you still have culling or flickering issues you can use the 'debugRenderBoxes', 'entityBoundingBoxGrowthList' and 'tileEntityBoundingBoxGrowthList' config options to try to fix the bounding box of that entity or tile entity.
+    B:tileEntityAABBGrowth=true
+
+    entity {
+        B:alwaysRenderBosses=true
+        B:alwaysRenderEntitiesWithName=true
+        B:alwaysRenderPlayers=true
+        B:alwaysRenderViewEntity=true
+        B:ignoreEndCrystalsWithBeam=true
+
+        # Skip rendering of entities that are not visible (hidden behind blocks). This might cause issues where an entity is partly behind a block and thus does not get rendered but it's usually not really noticable.
+        B:skipHiddenEntityRendering=true
+
+        # Tile entities which will always be rendered. (Accepts 'modid' or 'modid:entity_name')
+        S:skipHiddenEntityRenderingBlacklist <
+         >
+
+        # Entities with a width or height greater than this value will always get rendered.
+        # Min: 0.0
+        # Max: 1024.0
+        D:skipHiddenEntityRenderingSize=16.0
+    }
+
+    tileentity {
+        # Skip rendering of entities that are not visible (hidden behind blocks). This might cause issues where a tile entity is partly behind a block and thus does not get rendered but it's usually not really noticable.
+        B:skipHiddenTileEntityRendering=true
+
+        # Tile entities which will always be rendered. (Accepts 'modid' or 'modid:tile_entity_name')
+        S:skipHiddenTileEntityRenderingBlacklist <
+            enderio:tile_travel_anchor
+         >
+
+        # Tile entities with a width or height greater than this value will always get rendered.
+        # Min: 0.0
+        # Max: 1024.0
+        D:skipHiddenTileEntityRenderingSize=16.0
+    }
+
+    optifineshaderoptions {
+        B:entityShadowsCulling=true
+        B:entityShadowsCullingLessAggressiveMode=true
+
+        # Min: 0.0
+        # Max: 1024.0
+        D:entityShadowsCullingLessAggressiveModeDiff=4.0
+        B:tileEntityShadowsCulling=true
+        B:tileEntityShadowsCullingLessAggressiveMode=true
+
+        # Min: 0.0
+        # Max: 1024.0
+        D:tileEntityShadowsCullingLessAggressiveModeDiff=4.0
+    }
+
+}
+
+

servers/JiramasGalactic-1.12.2/files/config/falling_tree.cfg

@@ -0,0 +1,108 @@
+# Configuration file
+
+general {
+    # When set to true, the mod will cut down trees in creative too.
+    B:break_in_creative=false
+
+    # When set to true, a tree will only be chopped down if the player is sneaking.
+    B:reverse_sneaking=false
+}
+
+
+tools {
+    # List of tools that should not be considered as tools.
+    # INFO: This wins over the whitelist.
+    S:blacklisted <
+     >
+
+    # Defines the number of times the damage is applied to the tool.
+    # ie: if set to 1 then breaking 5 logs will give 5 damage.
+    # ie: if set to 2 then breaking 5 logs will give 10 damage.
+    # If set to 0, it'll still apply 1 damage for every cut.
+    # INFO: This only applies when the tree is cut when using the mod.
+    # Min: 0
+    # Max: 2147483647
+    I:damage_multiplicand=1
+
+    # When set to true, the mod will be activated no matter what you have in your hand (or empty hand).
+    # INFO: Blacklist still can be use to restrict some tools.
+    B:ignore_tools=false
+
+    # When set to true, when a tree is broken and the tool is about to break we will just break enough blocks so that the tool is left at 1 of durability.
+    B:preserve=false
+
+    # Applies a speed modifier when breaking the tree.
+    # 0 will disable this, so the speed will be the default one of breaking a block.
+    # If set to 1 each log block will be counted once, so if the tree is 5 blocks tall it'll require the time of breaking 5 logs.
+    # If set to 2 each log block will be counted twice, so if the tree is 5 blocks tall, it'll require the time of breaking 10 logs
+    # INFO: Only in INSTANTANEOUS mode.
+    # WARNING: If you are on a server, this either has to be set to 0 or every player should have the mod. Else they'll have a weird effect of breaking the block but the block is still there.
+    # Min: 0.0
+    # Max: 50.0
+    D:speed_multiplicand=0.0
+
+    # Additional list of tools that can be used to chop down a tree.
+    # INFO: Items marked with the axe tag will already be whitelisted.
+    S:whitelisted <
+     >
+}
+
+
+trees {
+    # When set to true this allow to have any kind of log in a tree trunk.
+    # Otherwise (false) the trunk will be considered as being only one kind of log.
+    B:allow_mixed_logs=false
+
+    # How to break the tree.
+    # Instantaneous will break it in one go.
+    # Shift down will make the tree fall down as you cut it, so you still have to break x blocks but don't have to climb the tree for them.
+    # Valid values:
+    # INSTANTANEOUS
+    # SHIFT_DOWN
+    S:break_mode=INSTANTANEOUS
+
+    # List of blocks that should not be considered as leaves.
+    # INFO: This wins over the whitelist.
+    S:leaves_blacklisted <
+     >
+
+    # When set to true, leaves that should naturally break will be broken instantly.
+    B:leaves_breaking=true
+
+    # Radius to force break leaves. If another tree is still holding the leaves they'll still be broken. If the leaves are persistent (placed by player) they'll also be destroyed.
+    # The radius is applied from one of the top most log blocks.
+    # INFO: break_leaves must be activated for this to take effect.
+    # INFO: Only in INSTANTANEOUS mode.
+    # Min: 0
+    # Max: 10
+    I:leaves_breaking_force_radius=0
+
+    # Additional list of blocks considered as leaves.
+    # INFO: Blocks marked with the leaves tag will already be whitelisted.
+    S:leaves_whitelisted <
+     >
+
+    # List of blocks that should not be considered as logs.
+    # INFO: This wins over the whitelist.
+    S:logs_blacklisted <
+     >
+
+    # The maximum size of a tree. If there's more logs than this value the tree won't be cut.
+    # INFO: Only in INSTANTANEOUS mode.
+    # Min: 1
+    # Max: 2147483647
+    I:logs_max_count=100
+
+    # Additional list of blocks considered as logs and that will be destroyed by the mod.
+    # INFO: Blocks marked with the log tag will already be whitelisted.
+    S:logs_whitelisted <
+     >
+
+    # The minimum amount of leaves that needs to be around the top most log in order for the mod to consider it a tree.
+    # INFO: Only in INSTANTANEOUS mode.
+    # Min: 0
+    # Max: 5
+    I:minimum_leaves_around_required=0
+}
+
+

servers/JiramasGalactic-1.12.2/files/config/fastbench.cfg

@@ -0,0 +1,11 @@
+# Configuration file
+
+crafting {
+    # If the recipe book and all associated functionality are fully removed. [default: true]
+    B:"Disable Recipe Book"=true
+
+    # If a testing variant of shift-click crafting is enabled. [default: true]
+    B:"Experiemental Shift Crafting"=true
+}
+
+

servers/JiramasGalactic-1.12.2/files/config/fastfurnace.cfg

@@ -0,0 +1,8 @@
+# Configuration file
+
+general {
+    # If the furnace uses nbt-sensitive output matching. [default: true]
+    B:"Strict Matching"=true
+}
+
+